C11H24N2O2 — CID 153386915
3-acetamido-N-butan-2-ylpropanamide;ethane (PubChem CID 153386915) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-acetamido-N-butan-2-ylpropanamide;ethane.
| Compound Name | 3-acetamido-N-butan-2-ylpropanamide;ethane |
|---|---|
| PubChem CID | 153386915 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 3-acetamido-N-butan-2-ylpropanamide;ethane |
| SMILES | CC.CCC(C)NC(=O)CCNC(C)=O |
| InChI | InChI=1S/C9H18N2O2.C2H6/c1-4-7(2)11-9(13)5-6-10-8(3)12;1-2/h7H,4-6H2,1-3H3,(H,10,12)(H,11,13);1-2H3 |
| InChIKey | JSEJAEIDCVYYOD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |