C11H24N4O — CID 111178184
N,N-dimethyl-3-[[N'-methyl-N-(2-methylpropyl)carbamimidoyl]amino]propanamide (PubChem CID 111178184) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is N,N-dimethyl-3-[[N'-methyl-N-(2-methylpropyl)carbamimidoyl]amino]propanamide.
| Compound Name | N,N-dimethyl-3-[[N'-methyl-N-(2-methylpropyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111178184 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | N,N-dimethyl-3-[[N'-methyl-N-(2-methylpropyl)carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCCC(=O)N(C)C)NCC(C)C |
| InChI | InChI=1S/C11H24N4O/c1-9(2)8-14-11(12-3)13-7-6-10(16)15(4)5/h9H,6-8H2,1-5H3,(H2,12,13,14) |
| InChIKey | WTFRMQHNCIAMOF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|