C12H26N4OS — CID 111627740
N,N-dimethyl-3-[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]propanamide (PubChem CID 111627740) has the molecular formula C12H26N4OS and a molecular weight of 274.43 g/mol. Its IUPAC name is N,N-dimethyl-3-[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]propanamide.
| Compound Name | N,N-dimethyl-3-[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111627740 |
| Molecular Formula | C12H26N4OS |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N,N-dimethyl-3-[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCCCCSC)NCCC(=O)N(C)C |
| InChI | InChI=1S/C12H26N4OS/c1-13-12(14-8-5-6-10-18-4)15-9-7-11(17)16(2)3/h5-10H2,1-4H3,(H2,13,14,15) |
| InChIKey | YOAMQSOOSDOPBU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|