C16H36N4S — CID 111628338
1-[7-(dimethylamino)heptyl]-2-methyl-3-(4-methylsulfanylbutyl)guanidine (PubChem CID 111628338) has the molecular formula C16H36N4S and a molecular weight of 316.56 g/mol. Its IUPAC name is 1-[7-(dimethylamino)heptyl]-2-methyl-3-(4-methylsulfanylbutyl)guanidine.
| Compound Name | 1-[7-(dimethylamino)heptyl]-2-methyl-3-(4-methylsulfanylbutyl)guanidine |
|---|---|
| PubChem CID | 111628338 |
| Molecular Formula | C16H36N4S |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.27 |
| IUPAC Name | 1-[7-(dimethylamino)heptyl]-2-methyl-3-(4-methylsulfanylbutyl)guanidine |
| SMILES | C/N=C(/NCCCCCCCN(C)C)NCCCCSC |
| InChI | InChI=1S/C16H36N4S/c1-17-16(19-13-9-11-15-21-4)18-12-8-6-5-7-10-14-20(2)3/h5-15H2,1-4H3,(H2,17,18,19) |
| InChIKey | LIMGJEPWDAMZAF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|