C7H17NS — CID 54463978
N,N-dimethyl-4-methylsulfanylbutan-1-amine (PubChem CID 54463978) has the molecular formula C7H17NS and a molecular weight of 147.29 g/mol. Its IUPAC name is N,N-dimethyl-4-methylsulfanylbutan-1-amine.
| Compound Name | N,N-dimethyl-4-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 54463978 |
| Molecular Formula | C7H17NS |
| Molecular Weight | 147.29 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | N,N-dimethyl-4-methylsulfanylbutan-1-amine |
| SMILES | CSCCCCN(C)C |
| InChI | InChI=1S/C7H17NS/c1-8(2)6-4-5-7-9-3/h4-7H2,1-3H3 |
| InChIKey | PTSAXKCFWGWZIY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|