C16H36N2S4 — CID 139749120
6-[6-(dimethylamino)hexyltetrasulfanyl]-N,N-dimethylhexan-1-amine (PubChem CID 139749120) has the molecular formula C16H36N2S4 and a molecular weight of 384.75 g/mol. Its IUPAC name is 6-[6-(dimethylamino)hexyltetrasulfanyl]-N,N-dimethylhexan-1-amine.
| Compound Name | 6-[6-(dimethylamino)hexyltetrasulfanyl]-N,N-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 139749120 |
| Molecular Formula | C16H36N2S4 |
| Molecular Weight | 384.75 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 6-[6-(dimethylamino)hexyltetrasulfanyl]-N,N-dimethylhexan-1-amine |
| SMILES | CN(C)CCCCCCSSSSCCCCCCN(C)C |
| InChI | InChI=1S/C16H36N2S4/c1-17(2)13-9-5-7-11-15-19-21-22-20-16-12-8-6-10-14-18(3)4/h5-16H2,1-4H3 |
| InChIKey | PXOTXHHEGMFOQH-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.75 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|