C7H18N2S — CID 144560896
N,N-dimethyl-4-(methylaminosulfanyl)butan-1-amine (PubChem CID 144560896) has the molecular formula C7H18N2S and a molecular weight of 162.30 g/mol. Its IUPAC name is N,N-dimethyl-4-(methylaminosulfanyl)butan-1-amine.
| Compound Name | N,N-dimethyl-4-(methylaminosulfanyl)butan-1-amine |
|---|---|
| PubChem CID | 144560896 |
| Molecular Formula | C7H18N2S |
| Molecular Weight | 162.30 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N,N-dimethyl-4-(methylaminosulfanyl)butan-1-amine |
| SMILES | CNSCCCCN(C)C |
| InChI | InChI=1S/C7H18N2S/c1-8-10-7-5-4-6-9(2)3/h8H,4-7H2,1-3H3 |
| InChIKey | YADVNMHSKAVKFR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|