C14H30ClN — CID 71338336
12-chloro-N,N-dimethyldodecan-1-amine (PubChem CID 71338336) has the molecular formula C14H30ClN and a molecular weight of 247.85 g/mol. Its IUPAC name is 12-chloro-N,N-dimethyldodecan-1-amine.
| Compound Name | 12-chloro-N,N-dimethyldodecan-1-amine |
|---|---|
| PubChem CID | 71338336 |
| Molecular Formula | C14H30ClN |
| Molecular Weight | 247.85 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | 12-chloro-N,N-dimethyldodecan-1-amine |
| SMILES | CN(C)CCCCCCCCCCCCCl |
| InChI | InChI=1S/C14H30ClN/c1-16(2)14-12-10-8-6-4-3-5-7-9-11-13-15/h3-14H2,1-2H3 |
| InChIKey | MZKIVJRINQVZPQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.85 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|