C11H25ClN2 — CID 63700093
N'-(5-chloropentyl)-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 63700093) has the molecular formula C11H25ClN2 and a molecular weight of 220.79 g/mol. Its IUPAC name is N'-(5-chloropentyl)-N,N,N'-trimethylpropane-1,3-diamine.
| Compound Name | N'-(5-chloropentyl)-N,N,N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63700093 |
| Molecular Formula | C11H25ClN2 |
| Molecular Weight | 220.79 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | N'-(5-chloropentyl)-N,N,N'-trimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN(C)CCCCCCl |
| InChI | InChI=1S/C11H25ClN2/c1-13(2)9-7-11-14(3)10-6-4-5-8-12/h4-11H2,1-3H3 |
| InChIKey | LKPAUBDIVAIQOQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.79 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|