C12H32Cl3N3 — CID 131875706
N'-[3-(dimethylamino)propyl]-N,N,N'-trimethylbutane-1,4-diamine;trihydrochloride (PubChem CID 131875706) has the molecular formula C12H32Cl3N3 and a molecular weight of 324.77 g/mol. Its IUPAC name is N'-[3-(dimethylamino)propyl]-N,N,N'-trimethylbutane-1,4-diamine;trihydrochloride.
| Compound Name | N'-[3-(dimethylamino)propyl]-N,N,N'-trimethylbutane-1,4-diamine;trihydrochloride |
|---|---|
| PubChem CID | 131875706 |
| Molecular Formula | C12H32Cl3N3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N'-[3-(dimethylamino)propyl]-N,N,N'-trimethylbutane-1,4-diamine;trihydrochloride |
| SMILES | CN(C)CCCCN(C)CCCN(C)C.Cl.Cl.Cl |
| InChI | InChI=1S/C12H29N3.3ClH/c1-13(2)9-6-7-11-15(5)12-8-10-14(3)4;;;/h6-12H2,1-5H3;3*1H |
| InChIKey | VFRUJSHDVMKELO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|