C12H29N3 — CID 63693646
1-N-[3-(dimethylamino)propyl]-1-N-methylhexane-1,5-diamine (PubChem CID 63693646) has the molecular formula C12H29N3 and a molecular weight of 215.38 g/mol. Its IUPAC name is 1-N-[3-(dimethylamino)propyl]-1-N-methylhexane-1,5-diamine.
| Compound Name | 1-N-[3-(dimethylamino)propyl]-1-N-methylhexane-1,5-diamine |
|---|---|
| PubChem CID | 63693646 |
| Molecular Formula | C12H29N3 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.24 |
| IUPAC Name | 1-N-[3-(dimethylamino)propyl]-1-N-methylhexane-1,5-diamine |
| SMILES | CC(N)CCCCN(C)CCCN(C)C |
| InChI | InChI=1S/C12H29N3/c1-12(13)8-5-6-10-15(4)11-7-9-14(2)3/h12H,5-11,13H2,1-4H3 |
| InChIKey | SZDFYXDCEADHIG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|