About N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane
N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane (PubChem CID 142350934) has the molecular formula C11H28N2
and a molecular weight of 188.36 g/mol. Its IUPAC name is N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane.
Analyze N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane?
The IUPAC name of N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane (CID 142350934) is N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane.
What is the SMILES notation for N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane?
The canonical SMILES for N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane is CCC.CCN(C)CCCN(C)C.
What is the InChIKey of N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane?
The InChIKey is QHGPFDYCHMQDPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2.C3H8/c1-5-10(4)8-6-7-9(2)3;1-3-2/h5-8H2,1-4H3;3H2,1-2H3.
What are the key properties of N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane?
N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane has a molecular weight of 188.36 g/mol, XLogP of 2.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N,N,N'-trimethylpropane-1,3-diamine;propane is sourced from PubChem (CID 142350934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).