About N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine
N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine (PubChem CID 118123590) has the molecular formula C10H26N2
and a molecular weight of 174.33 g/mol. Its IUPAC name is N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine.
Analyze N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine?
The IUPAC name of N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine (CID 118123590) is N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine.
What is the SMILES notation for N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine?
The canonical SMILES for N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine is CCCN(C)C.CCN(C)CC.
What is the InChIKey of N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine?
The InChIKey is SVHFXGRUIKJGFA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H13N/c1-4-5-6(2)3;1-4-6(3)5-2/h2*4-5H2,1-3H3.
What are the key properties of N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine?
N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine has a molecular weight of 174.33 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpropan-1-amine;N-ethyl-N-methylethanamine is sourced from PubChem (CID 118123590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).