About propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine
propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine (PubChem CID 144610913) has the molecular formula C11H28N2
and a molecular weight of 188.36 g/mol. Its IUPAC name is propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine.
Analyze propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine?
The IUPAC name of propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine (CID 144610913) is propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine.
What is the SMILES notation for propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine?
The canonical SMILES for propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine is CCC.CCCN(C)CCN(C)C.
What is the InChIKey of propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine?
The InChIKey is QALMAKUFPBNEIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2.C3H8/c1-5-6-10(4)8-7-9(2)3;1-3-2/h5-8H2,1-4H3;3H2,1-2H3.
What are the key properties of propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine?
propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine has a molecular weight of 188.36 g/mol, XLogP of 2.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane;N,N,N'-trimethyl-N'-propylethane-1,2-diamine is sourced from PubChem (CID 144610913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).