About methane;2-methylbutane;N-methyl-N-propylpropan-1-amine
methane;2-methylbutane;N-methyl-N-propylpropan-1-amine (PubChem CID 143703435) has the molecular formula C13H33N
and a molecular weight of 203.41 g/mol. Its IUPAC name is methane;2-methylbutane;N-methyl-N-propylpropan-1-amine.
Molecular Properties
| Compound Name | methane;2-methylbutane;N-methyl-N-propylpropan-1-amine |
| PubChem CID | 143703435 |
| Molecular Formula | C13H33N |
| Molecular Weight | 203.41 g/mol |
| Exact Mass | 203.26 |
| IUPAC Name | methane;2-methylbutane;N-methyl-N-propylpropan-1-amine |
| SMILES | C.CCC(C)C.CCCN(C)CCC |
| InChI | InChI=1S/C7H17N.C5H12.CH4/c1-4-6-8(3)7-5-2;1-4-5(2)3;/h4-7H2,1-3H3;5H,4H2,1-3H3;1H4 |
| InChIKey | SWZWCDUAZWYNEK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;2-methylbutane;N-methyl-N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylbutane;N-methyl-N-propylpropan-1-amine?
The IUPAC name of methane;2-methylbutane;N-methyl-N-propylpropan-1-amine (CID 143703435) is methane;2-methylbutane;N-methyl-N-propylpropan-1-amine.
What is the SMILES notation for methane;2-methylbutane;N-methyl-N-propylpropan-1-amine?
The canonical SMILES for methane;2-methylbutane;N-methyl-N-propylpropan-1-amine is C.CCC(C)C.CCCN(C)CCC.
What is the InChIKey of methane;2-methylbutane;N-methyl-N-propylpropan-1-amine?
The InChIKey is SWZWCDUAZWYNEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N.C5H12.CH4/c1-4-6-8(3)7-5-2;1-4-5(2)3;/h4-7H2,1-3H3;5H,4H2,1-3H3;1H4.
What are the key properties of methane;2-methylbutane;N-methyl-N-propylpropan-1-amine?
methane;2-methylbutane;N-methyl-N-propylpropan-1-amine has a molecular weight of 203.41 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylbutane;N-methyl-N-propylpropan-1-amine is sourced from PubChem (CID 143703435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).