C11H27N — CID 143004983
N,3-dimethyl-N-propylbutan-1-amine;ethane (PubChem CID 143004983) has the molecular formula C11H27N and a molecular weight of 173.34 g/mol. Its IUPAC name is N,3-dimethyl-N-propylbutan-1-amine;ethane.
| Compound Name | N,3-dimethyl-N-propylbutan-1-amine;ethane |
|---|---|
| PubChem CID | 143004983 |
| Molecular Formula | C11H27N |
| Molecular Weight | 173.34 g/mol |
| Exact Mass | 173.21 |
| IUPAC Name | N,3-dimethyl-N-propylbutan-1-amine;ethane |
| SMILES | CC.CCCN(C)CCC(C)C |
| InChI | InChI=1S/C9H21N.C2H6/c1-5-7-10(4)8-6-9(2)3;1-2/h9H,5-8H2,1-4H3;1-2H3 |
| InChIKey | DFLFEFAARZPDEK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |