C11H25N — CID 88539043
N-butyl-N,4-dimethylpentan-1-amine (PubChem CID 88539043) has the molecular formula C11H25N and a molecular weight of 171.33 g/mol. Its IUPAC name is N-butyl-N,4-dimethylpentan-1-amine.
| Compound Name | N-butyl-N,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 88539043 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | N-butyl-N,4-dimethylpentan-1-amine |
| SMILES | CCCCN(C)CCCC(C)C |
| InChI | InChI=1S/C11H25N/c1-5-6-9-12(4)10-7-8-11(2)3/h11H,5-10H2,1-4H3 |
| InChIKey | BDANZTGAXKFUEX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |