C9H20ClN — CID 83168960
N-(2-chloroethyl)-N,4-dimethylpentan-1-amine (PubChem CID 83168960) has the molecular formula C9H20ClN and a molecular weight of 177.72 g/mol. Its IUPAC name is N-(2-chloroethyl)-N,4-dimethylpentan-1-amine.
| Compound Name | N-(2-chloroethyl)-N,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 83168960 |
| Molecular Formula | C9H20ClN |
| Molecular Weight | 177.72 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N-(2-chloroethyl)-N,4-dimethylpentan-1-amine |
| SMILES | CC(C)CCCN(C)CCCl |
| InChI | InChI=1S/C9H20ClN/c1-9(2)5-4-7-11(3)8-6-10/h9H,4-8H2,1-3H3 |
| InChIKey | ZGJGGTDZYRYGLA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.72 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|