C7H16IN — CID 147099385
N-iodo-N,4-dimethylpentan-1-amine (PubChem CID 147099385) has the molecular formula C7H16IN and a molecular weight of 241.12 g/mol. Its IUPAC name is N-iodo-N,4-dimethylpentan-1-amine.
| Compound Name | N-iodo-N,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 147099385 |
| Molecular Formula | C7H16IN |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | N-iodo-N,4-dimethylpentan-1-amine |
| SMILES | CC(C)CCCN(C)I |
| InChI | InChI=1S/C7H16IN/c1-7(2)5-4-6-9(3)8/h7H,4-6H2,1-3H3 |
| InChIKey | BKJBSNYOLZZCRB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|