C18H40N2O — CID 162353486
N,4-dimethyl-N-[1-[1-[methyl(4-methylpentyl)amino]ethoxy]ethyl]pentan-1-amine (PubChem CID 162353486) has the molecular formula C18H40N2O and a molecular weight of 300.53 g/mol. Its IUPAC name is N,4-dimethyl-N-[1-[1-[methyl(4-methylpentyl)amino]ethoxy]ethyl]pentan-1-amine.
| Compound Name | N,4-dimethyl-N-[1-[1-[methyl(4-methylpentyl)amino]ethoxy]ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 162353486 |
| Molecular Formula | C18H40N2O |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.31 |
| IUPAC Name | N,4-dimethyl-N-[1-[1-[methyl(4-methylpentyl)amino]ethoxy]ethyl]pentan-1-amine |
| SMILES | CC(C)CCCN(C)C(C)OC(C)N(C)CCCC(C)C |
| InChI | InChI=1S/C18H40N2O/c1-15(2)11-9-13-19(7)17(5)21-18(6)20(8)14-10-12-16(3)4/h15-18H,9-14H2,1-8H3 |
| InChIKey | RWBIIIISGCCCFN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|