C20H46N2 — CID 159368359
N,5-dimethyl-N-propan-2-ylhexan-1-amine;4-methyl-N-propan-2-ylpentan-1-amine (PubChem CID 159368359) has the molecular formula C20H46N2 and a molecular weight of 314.60 g/mol. Its IUPAC name is N,5-dimethyl-N-propan-2-ylhexan-1-amine;4-methyl-N-propan-2-ylpentan-1-amine.
| Compound Name | N,5-dimethyl-N-propan-2-ylhexan-1-amine;4-methyl-N-propan-2-ylpentan-1-amine |
|---|---|
| PubChem CID | 159368359 |
| Molecular Formula | C20H46N2 |
| Molecular Weight | 314.60 g/mol |
| Exact Mass | 314.37 |
| IUPAC Name | N,5-dimethyl-N-propan-2-ylhexan-1-amine;4-methyl-N-propan-2-ylpentan-1-amine |
| SMILES | CC(C)CCCCN(C)C(C)C.CC(C)CCCNC(C)C |
| InChI | InChI=1S/C11H25N.C9H21N/c1-10(2)8-6-7-9-12(5)11(3)4;1-8(2)6-5-7-10-9(3)4/h10-11H,6-9H2,1-5H3;8-10H,5-7H2,1-4H3 |
| InChIKey | LJKMJYJUNOEYPL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|