C9H20FN — CID 142351395
N-(3-fluoropropyl)-N,3-dimethylbutan-1-amine (PubChem CID 142351395) has the molecular formula C9H20FN and a molecular weight of 161.26 g/mol. Its IUPAC name is N-(3-fluoropropyl)-N,3-dimethylbutan-1-amine.
| Compound Name | N-(3-fluoropropyl)-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 142351395 |
| Molecular Formula | C9H20FN |
| Molecular Weight | 161.26 g/mol |
| Exact Mass | 161.16 |
| IUPAC Name | N-(3-fluoropropyl)-N,3-dimethylbutan-1-amine |
| SMILES | CC(C)CCN(C)CCCF |
| InChI | InChI=1S/C9H20FN/c1-9(2)5-8-11(3)7-4-6-10/h9H,4-8H2,1-3H3 |
| InChIKey | LINVKHSVSZWPCI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |