C14H37N — CID 143818510
ethane;N-ethyl-N,3-dimethylbutan-1-amine (PubChem CID 143818510) has the molecular formula C14H37N and a molecular weight of 219.46 g/mol. Its IUPAC name is ethane;N-ethyl-N,3-dimethylbutan-1-amine.
| Compound Name | ethane;N-ethyl-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 143818510 |
| Molecular Formula | C14H37N |
| Molecular Weight | 219.46 g/mol |
| Exact Mass | 219.29 |
| IUPAC Name | ethane;N-ethyl-N,3-dimethylbutan-1-amine |
| SMILES | CC.CC.CC.CCN(C)CCC(C)C |
| InChI | InChI=1S/C8H19N.3C2H6/c1-5-9(4)7-6-8(2)3;3*1-2/h8H,5-7H2,1-4H3;3*1-2H3 |
| InChIKey | JKWKQVPISIYVAT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |