C10H25N — CID 144828505
propane;N,N,3-trimethylbutan-1-amine (PubChem CID 144828505) has the molecular formula C10H25N and a molecular weight of 159.32 g/mol. Its IUPAC name is propane;N,N,3-trimethylbutan-1-amine.
| Compound Name | propane;N,N,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 144828505 |
| Molecular Formula | C10H25N |
| Molecular Weight | 159.32 g/mol |
| Exact Mass | 159.20 |
| IUPAC Name | propane;N,N,3-trimethylbutan-1-amine |
| SMILES | CC(C)CCN(C)C.CCC |
| InChI | InChI=1S/C7H17N.C3H8/c1-7(2)5-6-8(3)4;1-3-2/h7H,5-6H2,1-4H3;3H2,1-2H3 |
| InChIKey | DMJKFGBWVSUTHI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |