About 3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine
3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine (PubChem CID 91045887) has the molecular formula C10H24N2
and a molecular weight of 172.32 g/mol. Its IUPAC name is 3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine.
Analyze 3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine?
The IUPAC name of 3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine (CID 91045887) is 3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine.
What is the SMILES notation for 3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine?
The canonical SMILES for 3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine is CCN(CC)C(C)CCN(C)C.
What is the InChIKey of 3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine?
The InChIKey is JGXQCAUZMAOCDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2/c1-6-12(7-2)10(3)8-9-11(4)5/h10H,6-9H2,1-5H3.
What are the key properties of 3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine?
3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine has a molecular weight of 172.32 g/mol, XLogP of 1.67, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-diethyl-1-N,1-N-dimethylbutane-1,3-diamine is sourced from PubChem (CID 91045887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).