C8H21N — CID 145274023
N,N-dimethylethanamine;2-methylpropane (PubChem CID 145274023) has the molecular formula C8H21N and a molecular weight of 131.26 g/mol. Its IUPAC name is N,N-dimethylethanamine;2-methylpropane.
| Compound Name | N,N-dimethylethanamine;2-methylpropane |
|---|---|
| PubChem CID | 145274023 |
| Molecular Formula | C8H21N |
| Molecular Weight | 131.26 g/mol |
| Exact Mass | 131.17 |
| IUPAC Name | N,N-dimethylethanamine;2-methylpropane |
| SMILES | CC(C)C.CCN(C)C |
| InChI | InChI=1S/C4H11N.C4H10/c1-4-5(2)3;1-4(2)3/h4H2,1-3H3;4H,1-3H3 |
| InChIKey | MQXWYKZODBDMQT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |