carbon dioxide;N,N-dimethylethanamine

C5H11NO2 — CID 158904946

IUPACcarbon dioxide;N,N-dimethylethanamine
SMILESCCN(C)C.O=C=O
InChIInChI=1S/C4H11N.CO2/c1-4-5(2)3;2-1-3/h4H2,1-3H3;
InChIKeyJFXUDASUTGGZFD-UHFFFAOYSA-N
MW117.15 g/mol
LogP-0.02
Rot. Bonds1

About carbon dioxide;N,N-dimethylethanamine

carbon dioxide;N,N-dimethylethanamine (PubChem CID 158904946) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is carbon dioxide;N,N-dimethylethanamine.

Molecular Properties

Compound Namecarbon dioxide;N,N-dimethylethanamine
PubChem CID158904946
Molecular FormulaC5H11NO2
Molecular Weight117.15 g/mol
Exact Mass117.08
IUPAC Namecarbon dioxide;N,N-dimethylethanamine
SMILESCCN(C)C.O=C=O
InChIInChI=1S/C4H11N.CO2/c1-4-5(2)3;2-1-3/h4H2,1-3H3;
InChIKeyJFXUDASUTGGZFD-UHFFFAOYSA-N
XLogP-0.02
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500117.15
LogP ≤ 5-0.02
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze carbon dioxide;N,N-dimethylethanamine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;N,N-dimethylethanamine?
The IUPAC name of carbon dioxide;N,N-dimethylethanamine (CID 158904946) is carbon dioxide;N,N-dimethylethanamine.
What is the SMILES notation for carbon dioxide;N,N-dimethylethanamine?
The canonical SMILES for carbon dioxide;N,N-dimethylethanamine is CCN(C)C.O=C=O.
What is the InChIKey of carbon dioxide;N,N-dimethylethanamine?
The InChIKey is JFXUDASUTGGZFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.CO2/c1-4-5(2)3;2-1-3/h4H2,1-3H3;.
What are the key properties of carbon dioxide;N,N-dimethylethanamine?
carbon dioxide;N,N-dimethylethanamine has a molecular weight of 117.15 g/mol, XLogP of -0.02, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;N,N-dimethylethanamine is sourced from PubChem (CID 158904946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).