C5H11NO2 — CID 158904946
carbon dioxide;N,N-dimethylethanamine (PubChem CID 158904946) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is carbon dioxide;N,N-dimethylethanamine.
| Compound Name | carbon dioxide;N,N-dimethylethanamine |
|---|---|
| PubChem CID | 158904946 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | carbon dioxide;N,N-dimethylethanamine |
| SMILES | CCN(C)C.O=C=O |
| InChI | InChI=1S/C4H11N.CO2/c1-4-5(2)3;2-1-3/h4H2,1-3H3; |
| InChIKey | JFXUDASUTGGZFD-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |