C4H12IN — CID 173048873
N,N-dimethylethanamine;hydroiodide (PubChem CID 173048873) has the molecular formula C4H12IN and a molecular weight of 201.05 g/mol. Its IUPAC name is N,N-dimethylethanamine;hydroiodide.
| Compound Name | N,N-dimethylethanamine;hydroiodide |
|---|---|
| PubChem CID | 173048873 |
| Molecular Formula | C4H12IN |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 201.00 |
| IUPAC Name | N,N-dimethylethanamine;hydroiodide |
| SMILES | CCN(C)C.I |
| InChI | InChI=1S/C4H11N.HI/c1-4-5(2)3;/h4H2,1-3H3;1H |
| InChIKey | XFKDMVZXPKLBQS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|