About N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane
N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane (PubChem CID 142201174) has the molecular formula C11H32N2
and a molecular weight of 192.39 g/mol. Its IUPAC name is N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane.
Analyze N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane?
The IUPAC name of N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane (CID 142201174) is N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane.
What is the SMILES notation for N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane?
The canonical SMILES for N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane is CC.CC.CCN(C)C.CN(C)C.
What is the InChIKey of N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane?
The InChIKey is LIMOLVYQFIQLPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.C3H9N.2C2H6/c1-4-5(2)3;1-4(2)3;2*1-2/h4H2,1-3H3;1-3H3;2*1-2H3.
What are the key properties of N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane?
N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane has a molecular weight of 192.39 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylethanamine;N,N-dimethylmethanamine;ethane is sourced from PubChem (CID 142201174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).