C7H22N2 — CID 145153553
N,N-dimethylethanamine;ethane;methanamine (PubChem CID 145153553) has the molecular formula C7H22N2 and a molecular weight of 134.27 g/mol. Its IUPAC name is N,N-dimethylethanamine;ethane;methanamine.
| Compound Name | N,N-dimethylethanamine;ethane;methanamine |
|---|---|
| PubChem CID | 145153553 |
| Molecular Formula | C7H22N2 |
| Molecular Weight | 134.27 g/mol |
| Exact Mass | 134.18 |
| IUPAC Name | N,N-dimethylethanamine;ethane;methanamine |
| SMILES | CC.CCN(C)C.CN |
| InChI | InChI=1S/C4H11N.C2H6.CH5N/c1-4-5(2)3;2*1-2/h4H2,1-3H3;1-2H3;2H2,1H3 |
| InChIKey | YAZCSTNEOXSJHB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |