C10H26N2 — CID 87629474
N,N-diethylethanamine;N,N-dimethylethanamine (PubChem CID 87629474) has the molecular formula C10H26N2 and a molecular weight of 174.33 g/mol. Its IUPAC name is N,N-diethylethanamine;N,N-dimethylethanamine.
| Compound Name | N,N-diethylethanamine;N,N-dimethylethanamine |
|---|---|
| PubChem CID | 87629474 |
| Molecular Formula | C10H26N2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.21 |
| IUPAC Name | N,N-diethylethanamine;N,N-dimethylethanamine |
| SMILES | CCN(C)C.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C4H11N/c1-4-7(5-2)6-3;1-4-5(2)3/h4-6H2,1-3H3;4H2,1-3H3 |
| InChIKey | AFAQJWCACINKFK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |