C4H14N2 — CID 91593223
azane;N,N-dimethylethanamine (PubChem CID 91593223) has the molecular formula C4H14N2 and a molecular weight of 90.17 g/mol. Its IUPAC name is azane;N,N-dimethylethanamine.
| Compound Name | azane;N,N-dimethylethanamine |
|---|---|
| PubChem CID | 91593223 |
| Molecular Formula | C4H14N2 |
| Molecular Weight | 90.17 g/mol |
| Exact Mass | 90.12 |
| IUPAC Name | azane;N,N-dimethylethanamine |
| SMILES | CCN(C)C.N |
| InChI | InChI=1S/C4H11N.H3N/c1-4-5(2)3;/h4H2,1-3H3;1H3 |
| InChIKey | RFRBDKXPZAJMRU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 90.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |