C7H20N2 — CID 143334981
N,N-dimethylethanamine;N-methylethanamine (PubChem CID 143334981) has the molecular formula C7H20N2 and a molecular weight of 132.25 g/mol. Its IUPAC name is N,N-dimethylethanamine;N-methylethanamine.
| Compound Name | N,N-dimethylethanamine;N-methylethanamine |
|---|---|
| PubChem CID | 143334981 |
| Molecular Formula | C7H20N2 |
| Molecular Weight | 132.25 g/mol |
| Exact Mass | 132.16 |
| IUPAC Name | N,N-dimethylethanamine;N-methylethanamine |
| SMILES | CCN(C)C.CCNC |
| InChI | InChI=1S/C4H11N.C3H9N/c1-4-5(2)3;1-3-4-2/h4H2,1-3H3;4H,3H2,1-2H3 |
| InChIKey | GVPCNGHUXFEGIT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |