C6H20I2N2 — CID 158364938
N,N-dimethylethanamine;N-methylmethanamine;dihydroiodide (PubChem CID 158364938) has the molecular formula C6H20I2N2 and a molecular weight of 374.05 g/mol. Its IUPAC name is N,N-dimethylethanamine;N-methylmethanamine;dihydroiodide.
| Compound Name | N,N-dimethylethanamine;N-methylmethanamine;dihydroiodide |
|---|---|
| PubChem CID | 158364938 |
| Molecular Formula | C6H20I2N2 |
| Molecular Weight | 374.05 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | N,N-dimethylethanamine;N-methylmethanamine;dihydroiodide |
| SMILES | CCN(C)C.CNC.I.I |
| InChI | InChI=1S/C4H11N.C2H7N.2HI/c1-4-5(2)3;1-3-2;;/h4H2,1-3H3;3H,1-2H3;2*1H |
| InChIKey | AKHRECXJQGTVSZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.05 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|