C8H27N — CID 159924855
N,N-dimethylethanamine;methane (PubChem CID 159924855) has the molecular formula C8H27N and a molecular weight of 137.31 g/mol. Its IUPAC name is N,N-dimethylethanamine;methane.
| Compound Name | N,N-dimethylethanamine;methane |
|---|---|
| PubChem CID | 159924855 |
| Molecular Formula | C8H27N |
| Molecular Weight | 137.31 g/mol |
| Exact Mass | 137.21 |
| IUPAC Name | N,N-dimethylethanamine;methane |
| SMILES | C.C.C.C.CCN(C)C |
| InChI | InChI=1S/C4H11N.4CH4/c1-4-5(2)3;;;;/h4H2,1-3H3;4*1H4 |
| InChIKey | NYWLNWKTEQTQFV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |