About N,N-diethylethanamine;1,1-dimethylhydrazine
N,N-diethylethanamine;1,1-dimethylhydrazine (PubChem CID 87141357) has the molecular formula C8H23N3
and a molecular weight of 161.29 g/mol. Its IUPAC name is N,N-diethylethanamine;1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | N,N-diethylethanamine;1,1-dimethylhydrazine |
| PubChem CID | 87141357 |
| Molecular Formula | C8H23N3 |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.19 |
| IUPAC Name | N,N-diethylethanamine;1,1-dimethylhydrazine |
| SMILES | CCN(CC)CC.CN(C)N |
| InChI | InChI=1S/C6H15N.C2H8N2/c1-4-7(5-2)6-3;1-4(2)3/h4-6H2,1-3H3;3H2,1-2H3 |
| InChIKey | XIKIQPBZHXRNSQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;1,1-dimethylhydrazine?
The IUPAC name of N,N-diethylethanamine;1,1-dimethylhydrazine (CID 87141357) is N,N-diethylethanamine;1,1-dimethylhydrazine.
What is the SMILES notation for N,N-diethylethanamine;1,1-dimethylhydrazine?
The canonical SMILES for N,N-diethylethanamine;1,1-dimethylhydrazine is CCN(CC)CC.CN(C)N.
What is the InChIKey of N,N-diethylethanamine;1,1-dimethylhydrazine?
The InChIKey is XIKIQPBZHXRNSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C2H8N2/c1-4-7(5-2)6-3;1-4(2)3/h4-6H2,1-3H3;3H2,1-2H3.
What are the key properties of N,N-diethylethanamine;1,1-dimethylhydrazine?
N,N-diethylethanamine;1,1-dimethylhydrazine has a molecular weight of 161.29 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;1,1-dimethylhydrazine is sourced from PubChem (CID 87141357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).