C8H23N3 — CID 87141357
N,N-diethylethanamine;1,1-dimethylhydrazine (PubChem CID 87141357) has the molecular formula C8H23N3 and a molecular weight of 161.29 g/mol. Its IUPAC name is N,N-diethylethanamine;1,1-dimethylhydrazine.
| Compound Name | N,N-diethylethanamine;1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 87141357 |
| Molecular Formula | C8H23N3 |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.19 |
| IUPAC Name | N,N-diethylethanamine;1,1-dimethylhydrazine |
| SMILES | CCN(CC)CC.CN(C)N |
| InChI | InChI=1S/C6H15N.C2H8N2/c1-4-7(5-2)6-3;1-4(2)3/h4-6H2,1-3H3;3H2,1-2H3 |
| InChIKey | XIKIQPBZHXRNSQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|