C7H17NO3 — CID 174810971
N,N-dimethylethanamine;2-hydroxypropanoic acid (PubChem CID 174810971) has the molecular formula C7H17NO3 and a molecular weight of 163.22 g/mol. Its IUPAC name is N,N-dimethylethanamine;2-hydroxypropanoic acid.
| Compound Name | N,N-dimethylethanamine;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 174810971 |
| Molecular Formula | C7H17NO3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | N,N-dimethylethanamine;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.CCN(C)C |
| InChI | InChI=1S/C4H11N.C3H6O3/c1-4-5(2)3;1-2(4)3(5)6/h4H2,1-3H3;2,4H,1H3,(H,5,6) |
| InChIKey | BZRYWZMDTBZXDA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |