N,N-dimethylethanamine;2-hydroxypropanoic acid

C7H17NO3 — CID 174810971

IUPACN,N-dimethylethanamine;2-hydroxypropanoic acid
SMILESCC(O)C(=O)O.CCN(C)C
InChIInChI=1S/C4H11N.C3H6O3/c1-4-5(2)3;1-2(4)3(5)6/h4H2,1-3H3;2,4H,1H3,(H,5,6)
InChIKeyBZRYWZMDTBZXDA-UHFFFAOYSA-N
MW163.22 g/mol
LogP0.02
Rot. Bonds2

About N,N-dimethylethanamine;2-hydroxypropanoic acid

N,N-dimethylethanamine;2-hydroxypropanoic acid (PubChem CID 174810971) has the molecular formula C7H17NO3 and a molecular weight of 163.22 g/mol. Its IUPAC name is N,N-dimethylethanamine;2-hydroxypropanoic acid.

Molecular Properties

Compound NameN,N-dimethylethanamine;2-hydroxypropanoic acid
PubChem CID174810971
Molecular FormulaC7H17NO3
Molecular Weight163.22 g/mol
Exact Mass163.12
IUPAC NameN,N-dimethylethanamine;2-hydroxypropanoic acid
SMILESCC(O)C(=O)O.CCN(C)C
InChIInChI=1S/C4H11N.C3H6O3/c1-4-5(2)3;1-2(4)3(5)6/h4H2,1-3H3;2,4H,1H3,(H,5,6)
InChIKeyBZRYWZMDTBZXDA-UHFFFAOYSA-N
XLogP0.02
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.22
LogP ≤ 50.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze N,N-dimethylethanamine;2-hydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-dimethylethanamine;2-hydroxypropanoic acid?
The IUPAC name of N,N-dimethylethanamine;2-hydroxypropanoic acid (CID 174810971) is N,N-dimethylethanamine;2-hydroxypropanoic acid.
What is the SMILES notation for N,N-dimethylethanamine;2-hydroxypropanoic acid?
The canonical SMILES for N,N-dimethylethanamine;2-hydroxypropanoic acid is CC(O)C(=O)O.CCN(C)C.
What is the InChIKey of N,N-dimethylethanamine;2-hydroxypropanoic acid?
The InChIKey is BZRYWZMDTBZXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.C3H6O3/c1-4-5(2)3;1-2(4)3(5)6/h4H2,1-3H3;2,4H,1H3,(H,5,6).
What are the key properties of N,N-dimethylethanamine;2-hydroxypropanoic acid?
N,N-dimethylethanamine;2-hydroxypropanoic acid has a molecular weight of 163.22 g/mol, XLogP of 0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylethanamine;2-hydroxypropanoic acid is sourced from PubChem (CID 174810971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).