About 2-hydroxypropanoic acid;propanoic acid
2-hydroxypropanoic acid;propanoic acid (PubChem CID 175004384) has the molecular formula C9H18O7
and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-hydroxypropanoic acid;propanoic acid.
Molecular Properties
| Compound Name | 2-hydroxypropanoic acid;propanoic acid |
| PubChem CID | 175004384 |
| Molecular Formula | C9H18O7 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-hydroxypropanoic acid;propanoic acid |
| SMILES | CC(O)C(=O)O.CCC(=O)O.CCC(=O)O |
| InChI | InChI=1S/C3H6O3.2C3H6O2/c1-2(4)3(5)6;2*1-2-3(4)5/h2,4H,1H3,(H,5,6);2*2H2,1H3,(H,4,5) |
| InChIKey | RRIFSPBXRIOMRX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxypropanoic acid;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoic acid;propanoic acid?
The IUPAC name of 2-hydroxypropanoic acid;propanoic acid (CID 175004384) is 2-hydroxypropanoic acid;propanoic acid.
What is the SMILES notation for 2-hydroxypropanoic acid;propanoic acid?
The canonical SMILES for 2-hydroxypropanoic acid;propanoic acid is CC(O)C(=O)O.CCC(=O)O.CCC(=O)O.
What is the InChIKey of 2-hydroxypropanoic acid;propanoic acid?
The InChIKey is RRIFSPBXRIOMRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3.2C3H6O2/c1-2(4)3(5)6;2*1-2-3(4)5/h2,4H,1H3,(H,5,6);2*2H2,1H3,(H,4,5).
What are the key properties of 2-hydroxypropanoic acid;propanoic acid?
2-hydroxypropanoic acid;propanoic acid has a molecular weight of 238.24 g/mol, XLogP of 0.41, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoic acid;propanoic acid is sourced from PubChem (CID 175004384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).