C9H16O9 — CID 172861837
2-hydroxypropanoic acid;propanedioic acid;propanoic acid (PubChem CID 172861837) has the molecular formula C9H16O9 and a molecular weight of 268.22 g/mol. Its IUPAC name is 2-hydroxypropanoic acid;propanedioic acid;propanoic acid.
| Compound Name | 2-hydroxypropanoic acid;propanedioic acid;propanoic acid |
|---|---|
| PubChem CID | 172861837 |
| Molecular Formula | C9H16O9 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-hydroxypropanoic acid;propanedioic acid;propanoic acid |
| SMILES | CC(O)C(=O)O.CCC(=O)O.O=C(O)CC(=O)O |
| InChI | InChI=1S/C3H4O4.C3H6O3.C3H6O2/c4-2(5)1-3(6)7;1-2(4)3(5)6;1-2-3(4)5/h1H2,(H,4,5)(H,6,7);2,4H,1H3,(H,5,6);2H2,1H3,(H,4,5) |
| InChIKey | ZLNDHXOOMNUUCQ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|