C6H14FN — CID 142449569
3-fluoro-N,N-dimethylbutan-1-amine (PubChem CID 142449569) has the molecular formula C6H14FN and a molecular weight of 119.18 g/mol. Its IUPAC name is 3-fluoro-N,N-dimethylbutan-1-amine.
| Compound Name | 3-fluoro-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 142449569 |
| Molecular Formula | C6H14FN |
| Molecular Weight | 119.18 g/mol |
| Exact Mass | 119.11 |
| IUPAC Name | 3-fluoro-N,N-dimethylbutan-1-amine |
| SMILES | CC(F)CCN(C)C |
| InChI | InChI=1S/C6H14FN/c1-6(7)4-5-8(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | POZIFHNAFDNEHD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |