C7H17FN2 — CID 175905976
2-fluoro-N,N',N'-trimethylbutane-1,4-diamine (PubChem CID 175905976) has the molecular formula C7H17FN2 and a molecular weight of 148.22 g/mol. Its IUPAC name is 2-fluoro-N,N',N'-trimethylbutane-1,4-diamine.
| Compound Name | 2-fluoro-N,N',N'-trimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 175905976 |
| Molecular Formula | C7H17FN2 |
| Molecular Weight | 148.22 g/mol |
| Exact Mass | 148.14 |
| IUPAC Name | 2-fluoro-N,N',N'-trimethylbutane-1,4-diamine |
| SMILES | CNCC(F)CCN(C)C |
| InChI | InChI=1S/C7H17FN2/c1-9-6-7(8)4-5-10(2)3/h7,9H,4-6H2,1-3H3 |
| InChIKey | GMQLAYULQBUOGQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |