C5H14N2O3S — CID 141017852
1-azaniumyl-3-(dimethylamino)propane-1-sulfonate (PubChem CID 141017852) has the molecular formula C5H14N2O3S and a molecular weight of 182.24 g/mol. Its IUPAC name is 1-azaniumyl-3-(dimethylamino)propane-1-sulfonate.
| Compound Name | 1-azaniumyl-3-(dimethylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 141017852 |
| Molecular Formula | C5H14N2O3S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 1-azaniumyl-3-(dimethylamino)propane-1-sulfonate |
| SMILES | CN(C)CCC([NH3+])S(=O)(=O)[O-] |
| InChI | InChI=1S/C5H14N2O3S/c1-7(2)4-3-5(6)11(8,9)10/h5H,3-4,6H2,1-2H3,(H,8,9,10) |
| InChIKey | VMDXOWJYKXVTNB-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|