C7H18N2O3S — CID 87176148
1,3-bis(dimethylamino)propane-1-sulfonic acid (PubChem CID 87176148) has the molecular formula C7H18N2O3S and a molecular weight of 210.30 g/mol. Its IUPAC name is 1,3-bis(dimethylamino)propane-1-sulfonic acid.
| Compound Name | 1,3-bis(dimethylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 87176148 |
| Molecular Formula | C7H18N2O3S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1,3-bis(dimethylamino)propane-1-sulfonic acid |
| SMILES | CN(C)CCC(N(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C7H18N2O3S/c1-8(2)6-5-7(9(3)4)13(10,11)12/h7H,5-6H2,1-4H3,(H,10,11,12) |
| InChIKey | JOKOVOQLDAORHU-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|