C5H14ClNO2 — CID 173336782
3-(dimethylamino)propane-1,1-diol;hydrochloride (PubChem CID 173336782) has the molecular formula C5H14ClNO2 and a molecular weight of 155.62 g/mol. Its IUPAC name is 3-(dimethylamino)propane-1,1-diol;hydrochloride.
| Compound Name | 3-(dimethylamino)propane-1,1-diol;hydrochloride |
|---|---|
| PubChem CID | 173336782 |
| Molecular Formula | C5H14ClNO2 |
| Molecular Weight | 155.62 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 3-(dimethylamino)propane-1,1-diol;hydrochloride |
| SMILES | CN(C)CCC(O)O.Cl |
| InChI | InChI=1S/C5H13NO2.ClH/c1-6(2)4-3-5(7)8;/h5,7-8H,3-4H2,1-2H3;1H |
| InChIKey | XJFJNAZBGZFSII-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.62 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|