C9H22N2O — CID 57282569
3,5-bis(dimethylamino)pentan-2-ol (PubChem CID 57282569) has the molecular formula C9H22N2O and a molecular weight of 174.29 g/mol. Its IUPAC name is 3,5-bis(dimethylamino)pentan-2-ol.
| Compound Name | 3,5-bis(dimethylamino)pentan-2-ol |
|---|---|
| PubChem CID | 57282569 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | 3,5-bis(dimethylamino)pentan-2-ol |
| SMILES | CC(O)C(CCN(C)C)N(C)C |
| InChI | InChI=1S/C9H22N2O/c1-8(12)9(11(4)5)6-7-10(2)3/h8-9,12H,6-7H2,1-5H3 |
| InChIKey | BQEODJWDCFMSGN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |