C6H16NOP — CID 89417528
N,N-dimethyl-3-phosphanyloxybutan-1-amine (PubChem CID 89417528) has the molecular formula C6H16NOP and a molecular weight of 149.17 g/mol. Its IUPAC name is N,N-dimethyl-3-phosphanyloxybutan-1-amine.
| Compound Name | N,N-dimethyl-3-phosphanyloxybutan-1-amine |
|---|---|
| PubChem CID | 89417528 |
| Molecular Formula | C6H16NOP |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | N,N-dimethyl-3-phosphanyloxybutan-1-amine |
| SMILES | CC(CCN(C)C)OP |
| InChI | InChI=1S/C6H16NOP/c1-6(8-9)4-5-7(2)3/h6H,4-5,9H2,1-3H3 |
| InChIKey | KHAWZQUQGMNDLQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|