C9H20ClNO — CID 88737758
3-chloro-N,N-dimethyl-3-(2-methylpropoxy)propan-1-amine (PubChem CID 88737758) has the molecular formula C9H20ClNO and a molecular weight of 193.72 g/mol. Its IUPAC name is 3-chloro-N,N-dimethyl-3-(2-methylpropoxy)propan-1-amine.
| Compound Name | 3-chloro-N,N-dimethyl-3-(2-methylpropoxy)propan-1-amine |
|---|---|
| PubChem CID | 88737758 |
| Molecular Formula | C9H20ClNO |
| Molecular Weight | 193.72 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 3-chloro-N,N-dimethyl-3-(2-methylpropoxy)propan-1-amine |
| SMILES | CC(C)COC(Cl)CCN(C)C |
| InChI | InChI=1S/C9H20ClNO/c1-8(2)7-12-9(10)5-6-11(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | NXRGSEUBQBUKNJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.72 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|