C11H24ClNO — CID 88634228
3-chloro-N,N-diethyl-3-(2-methylpropoxy)propan-1-amine (PubChem CID 88634228) has the molecular formula C11H24ClNO and a molecular weight of 221.77 g/mol. Its IUPAC name is 3-chloro-N,N-diethyl-3-(2-methylpropoxy)propan-1-amine.
| Compound Name | 3-chloro-N,N-diethyl-3-(2-methylpropoxy)propan-1-amine |
|---|---|
| PubChem CID | 88634228 |
| Molecular Formula | C11H24ClNO |
| Molecular Weight | 221.77 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-chloro-N,N-diethyl-3-(2-methylpropoxy)propan-1-amine |
| SMILES | CCN(CC)CCC(Cl)OCC(C)C |
| InChI | InChI=1S/C11H24ClNO/c1-5-13(6-2)8-7-11(12)14-9-10(3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | XXGAQMSJLMPYLJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.77 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|