C11H25NO — CID 10773944
4-ethoxy-N,N-diethyl-3-methylbutan-1-amine (PubChem CID 10773944) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is 4-ethoxy-N,N-diethyl-3-methylbutan-1-amine.
| Compound Name | 4-ethoxy-N,N-diethyl-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 10773944 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 4-ethoxy-N,N-diethyl-3-methylbutan-1-amine |
| SMILES | CCOCC(C)CCN(CC)CC |
| InChI | InChI=1S/C11H25NO/c1-5-12(6-2)9-8-11(4)10-13-7-3/h11H,5-10H2,1-4H3 |
| InChIKey | CUMGNYBPHCTSPX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |