C9H20O2 — CID 59899860
1,4-diethoxy-2-methylbutane (PubChem CID 59899860) has the molecular formula C9H20O2 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1,4-diethoxy-2-methylbutane.
| Compound Name | 1,4-diethoxy-2-methylbutane |
|---|---|
| PubChem CID | 59899860 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | 1,4-diethoxy-2-methylbutane |
| SMILES | CCOCCC(C)COCC |
| InChI | InChI=1S/C9H20O2/c1-4-10-7-6-9(3)8-11-5-2/h9H,4-8H2,1-3H3 |
| InChIKey | IQEWCSRLCCRBMK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|